C26H30ClN7O3S — CID 58116972
4-[(E)-4-[3-(3-chloro-5-hydroxyanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enyl]-N,N-dimethylpiperazine-1-carboxamide (PubChem CID 58116972) has the molecular formula C26H30ClN7O3S and a molecular weight of 556.09 g/mol. Its IUPAC name is 4-[(E)-4-[3-(3-chloro-5-hydroxyanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enyl]-N,N-dimethylpiperazine-1-carboxamide.
| Compound Name | 4-[(E)-4-[3-(3-chloro-5-hydroxyanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enyl]-N,N-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 58116972 |
| Molecular Formula | C26H30ClN7O3S |
| Molecular Weight | 556.09 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | 4-[(E)-4-[3-(3-chloro-5-hydroxyanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enyl]-N,N-dimethylpiperazine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCN(C/C=C/C(=O)N2CCc3c(sc4ncnc(Nc5cc(O)cc(Cl)c5)c34)C2)CC1 |
| InChI | InChI=1S/C26H30ClN7O3S/c1-31(2)26(37)33-10-8-32(9-11-33)6-3-4-22(36)34-7-5-20-21(15-34)38-25-23(20)24(28-16-29-25)30-18-12-17(27)13-19(35)14-18/h3-4,12-14,16,35H,5-11,15H2,1-2H3,(H,28,29,30)/b4-3+ |
| InChIKey | HOZFSDISYNHEDV-ONEGZZNKSA-N |
| XLogP | 3.53 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.09 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|