C25H26ClN5O3S — CID 66849934
1-[3-(3-chloro-5-hydroxyanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)but-2-en-1-one (PubChem CID 66849934) has the molecular formula C25H26ClN5O3S and a molecular weight of 512.04 g/mol. Its IUPAC name is 1-[3-(3-chloro-5-hydroxyanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)but-2-en-1-one.
| Compound Name | 1-[3-(3-chloro-5-hydroxyanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 66849934 |
| Molecular Formula | C25H26ClN5O3S |
| Molecular Weight | 512.04 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 1-[3-(3-chloro-5-hydroxyanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)but-2-en-1-one |
| SMILES | O=C(C=CCN1CC2CCC(C1)O2)N1CCc2c(sc3ncnc(Nc4cc(O)cc(Cl)c4)c23)C1 |
| InChI | InChI=1S/C25H26ClN5O3S/c26-15-8-16(10-17(32)9-15)29-24-23-20-5-7-31(13-21(20)35-25(23)28-14-27-24)22(33)2-1-6-30-11-18-3-4-19(12-30)34-18/h1-2,8-10,14,18-19,32H,3-7,11-13H2,(H,27,28,29) |
| InChIKey | HNTJLXNKQDJFCU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.04 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|