C23H44O2Si — CID 58193152
(1S,4S,4aS,5S,6R,7S,8aR)-6-[(E)-but-2-en-2-yl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol (PubChem CID 58193152) has the molecular formula C23H44O2Si and a molecular weight of 380.69 g/mol. Its IUPAC name is (1S,4S,4aS,5S,6R,7S,8aR)-6-[(E)-but-2-en-2-yl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol.
| Compound Name | (1S,4S,4aS,5S,6R,7S,8aR)-6-[(E)-but-2-en-2-yl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 58193152 |
| Molecular Formula | C23H44O2Si |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | (1S,4S,4aS,5S,6R,7S,8aR)-6-[(E)-but-2-en-2-yl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol |
| SMILES | C/C=C(\C)[C@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H]2[C@@H](C[C@@H]1C)[C@@H](O)CC[C@@H]2C |
| InChI | InChI=1S/C23H44O2Si/c1-10-15(2)21-17(4)13-18-20(24)12-11-16(3)22(18)19(21)14-25-26(8,9)23(5,6)7/h10,16-22,24H,11-14H2,1-9H3/b15-10+/t16-,17-,18-,19+,20-,21+,22+/m0/s1 |
| InChIKey | MHAYOYHANDJYOB-XKYRHIJCSA-N |
| XLogP | 6.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|