C26H22F6N4O3S — CID 58311708
(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-3-methylindazol-5-yl]methylidene]-2-[(2S)-2-(hydroxymethyl)morpholin-4-yl]-1,3-thiazol-4-one (PubChem CID 58311708) has the molecular formula C26H22F6N4O3S and a molecular weight of 584.54 g/mol. Its IUPAC name is (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-3-methylindazol-5-yl]methylidene]-2-[(2S)-2-(hydroxymethyl)morpholin-4-yl]-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-3-methylindazol-5-yl]methylidene]-2-[(2S)-2-(hydroxymethyl)morpholin-4-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 58311708 |
| Molecular Formula | C26H22F6N4O3S |
| Molecular Weight | 584.54 g/mol |
| Exact Mass | 584.13 |
| IUPAC Name | (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-3-methylindazol-5-yl]methylidene]-2-[(2S)-2-(hydroxymethyl)morpholin-4-yl]-1,3-thiazol-4-one |
| SMILES | Cc1nn(Cc2ccc(C(F)(F)F)cc2C(F)(F)F)c2ccc(/C=C3\SC(N4CCO[C@H](CO)C4)=NC3=O)cc12 |
| InChI | InChI=1S/C26H22F6N4O3S/c1-14-19-8-15(9-22-23(38)33-24(40-22)35-6-7-39-18(12-35)13-37)2-5-21(19)36(34-14)11-16-3-4-17(25(27,28)29)10-20(16)26(30,31)32/h2-5,8-10,18,37H,6-7,11-13H2,1H3/b22-9-/t18-/m0/s1 |
| InChIKey | KXDKYNVMCYBLEV-VNLNYSPOSA-N |
| XLogP | 5.09 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|