C24H20BrF3N4O3S — CID 58311763
(5Z)-5-[[1-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(2R)-2-(hydroxymethyl)morpholin-4-yl]-1,3-thiazol-4-one (PubChem CID 58311763) has the molecular formula C24H20BrF3N4O3S and a molecular weight of 581.41 g/mol. Its IUPAC name is (5Z)-5-[[1-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(2R)-2-(hydroxymethyl)morpholin-4-yl]-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[1-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(2R)-2-(hydroxymethyl)morpholin-4-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 58311763 |
| Molecular Formula | C24H20BrF3N4O3S |
| Molecular Weight | 581.41 g/mol |
| Exact Mass | 580.04 |
| IUPAC Name | (5Z)-5-[[1-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(2R)-2-(hydroxymethyl)morpholin-4-yl]-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCO[C@@H](CO)C2)S/C1=C\c1ccc2c(cnn2Cc2ccc(Br)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C24H20BrF3N4O3S/c25-17-3-2-15(19(9-17)24(26,27)28)11-32-20-4-1-14(7-16(20)10-29-32)8-21-22(34)30-23(36-21)31-5-6-35-18(12-31)13-33/h1-4,7-10,18,33H,5-6,11-13H2/b21-8-/t18-/m1/s1 |
| InChIKey | XKXYAJKYIBBNLQ-CEVOVPAXSA-N |
| XLogP | 4.53 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|