C33H33N5O4 — CID 58624315
1-N-(3,4-dihydroquinolin-8-yl)-6-N-hydroxy-1-phenyl-1-N-quinolin-8-ylhexane-1,1,6-tricarboxamide (PubChem CID 58624315) has the molecular formula C33H33N5O4 and a molecular weight of 563.66 g/mol. Its IUPAC name is 1-N-(3,4-dihydroquinolin-8-yl)-6-N-hydroxy-1-phenyl-1-N-quinolin-8-ylhexane-1,1,6-tricarboxamide.
| Compound Name | 1-N-(3,4-dihydroquinolin-8-yl)-6-N-hydroxy-1-phenyl-1-N-quinolin-8-ylhexane-1,1,6-tricarboxamide |
|---|---|
| PubChem CID | 58624315 |
| Molecular Formula | C33H33N5O4 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | 1-N-(3,4-dihydroquinolin-8-yl)-6-N-hydroxy-1-phenyl-1-N-quinolin-8-ylhexane-1,1,6-tricarboxamide |
| SMILES | O=C(CCCCCC(C(=O)Nc1cccc2c1N=CCC2)(C(=O)Nc1cccc2cccnc12)c1ccccc1)NO |
| InChI | InChI=1S/C33H33N5O4/c39-28(38-42)19-5-2-6-20-33(25-15-3-1-4-16-25,31(40)36-26-17-7-11-23-13-9-21-34-29(23)26)32(41)37-27-18-8-12-24-14-10-22-35-30(24)27/h1,3-4,7-9,11-13,15-18,21-22,42H,2,5-6,10,14,19-20H2,(H,36,40)(H,37,41)(H,38,39) |
| InChIKey | CRVXQTSAVJVQEN-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|