C16H30N4Si — CID 58634914
(1S)-3-[dimethyl(1,3,5-triazinan-1-yl)silyl]-N,N-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-amine (PubChem CID 58634914) has the molecular formula C16H30N4Si and a molecular weight of 306.53 g/mol. Its IUPAC name is (1S)-3-[dimethyl(1,3,5-triazinan-1-yl)silyl]-N,N-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-amine.
| Compound Name | (1S)-3-[dimethyl(1,3,5-triazinan-1-yl)silyl]-N,N-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 58634914 |
| Molecular Formula | C16H30N4Si |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (1S)-3-[dimethyl(1,3,5-triazinan-1-yl)silyl]-N,N-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-amine |
| SMILES | CN(C)[C@H]1CC([Si](C)(C)N2CNCNC2)C2C=CC=CC21 |
| InChI | InChI=1S/C16H30N4Si/c1-19(2)15-9-16(14-8-6-5-7-13(14)15)21(3,4)20-11-17-10-18-12-20/h5-8,13-18H,9-12H2,1-4H3/t13?,14?,15-,16?/m0/s1 |
| InChIKey | GIHQBWVCULQTEL-UFFJXHMVSA-N |
| XLogP | 1.62 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|