C18H15N3V — CID 58904414
N-(2-ethenylbenzene-3-id-1-yl)-6,7-dimethylquinazolin-4-amine;vanadium(2+) (PubChem CID 58904414) has the molecular formula C18H15N3V and a molecular weight of 324.28 g/mol. Its IUPAC name is N-(2-ethenylbenzene-3-id-1-yl)-6,7-dimethylquinazolin-4-amine;vanadium(2+).
| Compound Name | N-(2-ethenylbenzene-3-id-1-yl)-6,7-dimethylquinazolin-4-amine;vanadium(2+) |
|---|---|
| PubChem CID | 58904414 |
| Molecular Formula | C18H15N3V |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | N-(2-ethenylbenzene-3-id-1-yl)-6,7-dimethylquinazolin-4-amine;vanadium(2+) |
| SMILES | [H]/[C-]=C/c1[c-]cccc1Nc1ncnc2cc(C)c(C)cc12.[V+2] |
| InChI | InChI=1S/C18H15N3.V/c1-4-14-7-5-6-8-16(14)21-18-15-9-12(2)13(3)10-17(15)19-11-20-18;/h1,4-6,8-11H,2-3H3,(H,19,20,21);/q-2;+2 |
| InChIKey | KEQLICYEFRFEBD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|