C40H42Cl2FeN2P+ — CID 58959076
2-[[2-(2,6-ditert-butylphenyl)iminoacenaphthylen-1-ylidene]amino]ethyl-diphenylphosphanium;dichloroiron (PubChem CID 58959076) has the molecular formula C40H42Cl2FeN2P+ and a molecular weight of 708.52 g/mol. Its IUPAC name is 2-[[2-(2,6-ditert-butylphenyl)iminoacenaphthylen-1-ylidene]amino]ethyl-diphenylphosphanium;dichloroiron.
| Compound Name | 2-[[2-(2,6-ditert-butylphenyl)iminoacenaphthylen-1-ylidene]amino]ethyl-diphenylphosphanium;dichloroiron |
|---|---|
| PubChem CID | 58959076 |
| Molecular Formula | C40H42Cl2FeN2P+ |
| Molecular Weight | 708.52 g/mol |
| Exact Mass | 707.18 |
| IUPAC Name | 2-[[2-(2,6-ditert-butylphenyl)iminoacenaphthylen-1-ylidene]amino]ethyl-diphenylphosphanium;dichloroiron |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1/N=C1C(=N/CC[PH+](c2ccccc2)c2ccccc2)/c2cccc3cccc/1c23.Cl[Fe]Cl |
| InChI | InChI=1S/C40H41N2P.2ClH.Fe/c1-39(2,3)33-24-15-25-34(40(4,5)6)38(33)42-37-32-23-14-17-28-16-13-22-31(35(28)32)36(37)41-26-27-43(29-18-9-7-10-19-29)30-20-11-8-12-21-30;;;/h7-25H,26-27H2,1-6H3;2*1H;/q;;;+2/p-1/b41-36+,42-37+;;; |
| InChIKey | DPWSJKRKWWZUSW-BJQFXWJXSA-M |
| XLogP | 10.60 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.52 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|