C32H40N6O7S2 — CID 59028850
tert-butyl N-[[(5S)-5-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-6-oxo-6-[(4-phenyl-1,3-thiazol-2-yl)amino]hexyl]sulfamoyl]carbamate (PubChem CID 59028850) has the molecular formula C32H40N6O7S2 and a molecular weight of 684.84 g/mol. Its IUPAC name is tert-butyl N-[[(5S)-5-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-6-oxo-6-[(4-phenyl-1,3-thiazol-2-yl)amino]hexyl]sulfamoyl]carbamate.
| Compound Name | tert-butyl N-[[(5S)-5-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-6-oxo-6-[(4-phenyl-1,3-thiazol-2-yl)amino]hexyl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 59028850 |
| Molecular Formula | C32H40N6O7S2 |
| Molecular Weight | 684.84 g/mol |
| Exact Mass | 684.24 |
| IUPAC Name | tert-butyl N-[[(5S)-5-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-6-oxo-6-[(4-phenyl-1,3-thiazol-2-yl)amino]hexyl]sulfamoyl]carbamate |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)N[C@@H](CCCCNS(=O)(=O)NC(=O)OC(C)(C)C)C(=O)Nc3nc(-c4ccccc4)cs3)c2c1 |
| InChI | InChI=1S/C32H40N6O7S2/c1-20-23(24-17-22(44-5)14-15-25(24)34-20)18-28(39)35-26(13-9-10-16-33-47(42,43)38-31(41)45-32(2,3)4)29(40)37-30-36-27(19-46-30)21-11-7-6-8-12-21/h6-8,11-12,14-15,17,19,26,33-34H,9-10,13,16,18H2,1-5H3,(H,35,39)(H,38,41)(H,36,37,40)/t26-/m0/s1 |
| InChIKey | WPFCATFCNSYWQR-SANMLTNESA-N |
| XLogP | 4.80 |
| TPSA | 180.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.84 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|