C34H34F3N5O7 — CID 67737553
3-[7-[3-[(2-amino-4-methyl-4H-pyrimidin-3-yl)oxy]propyl]-2,5-dioxo-1-phenyl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 67737553) has the molecular formula C34H34F3N5O7 and a molecular weight of 681.67 g/mol. Its IUPAC name is 3-[7-[3-[(2-amino-4-methyl-4H-pyrimidin-3-yl)oxy]propyl]-2,5-dioxo-1-phenyl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[7-[3-[(2-amino-4-methyl-4H-pyrimidin-3-yl)oxy]propyl]-2,5-dioxo-1-phenyl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67737553 |
| Molecular Formula | C34H34F3N5O7 |
| Molecular Weight | 681.67 g/mol |
| Exact Mass | 681.24 |
| IUPAC Name | 3-[7-[3-[(2-amino-4-methyl-4H-pyrimidin-3-yl)oxy]propyl]-2,5-dioxo-1-phenyl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC1C=CN=C(N)N1OCCCc1ccc2c(c1)C(=O)N(C(CC(=O)O)c1ccccc1)CC(=O)N2c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C32H33N5O5.C2HF3O2/c1-22-16-17-34-32(33)37(22)42-18-8-9-23-14-15-27-26(19-23)31(41)35(21-29(38)36(27)25-12-6-3-7-13-25)28(20-30(39)40)24-10-4-2-5-11-24;3-2(4,5)1(6)7/h2-7,10-17,19,22,28H,8-9,18,20-21H2,1H3,(H2,33,34)(H,39,40);(H,6,7) |
| InChIKey | HHPXJMIEEHOKMH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 166.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.67 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|