C18H17N5O2S2 — CID 68587009
N-[5-(2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)thiophen-3-yl]-5-cyanopyridine-2-carboxamide (PubChem CID 68587009) has the molecular formula C18H17N5O2S2 and a molecular weight of 399.50 g/mol. Its IUPAC name is N-[5-(2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)thiophen-3-yl]-5-cyanopyridine-2-carboxamide.
| Compound Name | N-[5-(2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)thiophen-3-yl]-5-cyanopyridine-2-carboxamide |
|---|---|
| PubChem CID | 68587009 |
| Molecular Formula | C18H17N5O2S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | N-[5-(2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)thiophen-3-yl]-5-cyanopyridine-2-carboxamide |
| SMILES | N#Cc1ccc(C(=O)Nc2csc(C34COCCC3CSC(N)=N4)c2)nc1 |
| InChI | InChI=1S/C18H17N5O2S2/c19-6-11-1-2-14(21-7-11)16(24)22-13-5-15(26-9-13)18-10-25-4-3-12(18)8-27-17(20)23-18/h1-2,5,7,9,12H,3-4,8,10H2,(H2,20,23)(H,22,24) |
| InChIKey | LAOKNTCIMWLGDD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |