C28H31F3N4O2 — CID 69143861
1-[5-(4,5-dihydro-1,3-oxazol-2-yl)isoindol-2-yl]-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]hexan-1-one (PubChem CID 69143861) has the molecular formula C28H31F3N4O2 and a molecular weight of 512.58 g/mol. Its IUPAC name is 1-[5-(4,5-dihydro-1,3-oxazol-2-yl)isoindol-2-yl]-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]hexan-1-one.
| Compound Name | 1-[5-(4,5-dihydro-1,3-oxazol-2-yl)isoindol-2-yl]-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 69143861 |
| Molecular Formula | C28H31F3N4O2 |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | 1-[5-(4,5-dihydro-1,3-oxazol-2-yl)isoindol-2-yl]-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]hexan-1-one |
| SMILES | O=C(CCCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1)n1cc2ccc(C3=NCCO3)cc2c1 |
| InChI | InChI=1S/C28H31F3N4O2/c29-28(30,31)24-5-4-6-25(18-24)34-14-12-33(13-15-34)11-3-1-2-7-26(36)35-19-22-9-8-21(17-23(22)20-35)27-32-10-16-37-27/h4-6,8-9,17-20H,1-3,7,10-16H2 |
| InChIKey | KEOZRFNHYCJRKS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 50.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|