C6H7N3O — CID 69288310
1-methylfuro[2,3-d]imidazol-5-amine (PubChem CID 69288310) has the molecular formula C6H7N3O and a molecular weight of 137.14 g/mol. Its IUPAC name is 1-methylfuro[2,3-d]imidazol-5-amine.
| Compound Name | 1-methylfuro[2,3-d]imidazol-5-amine |
|---|---|
| PubChem CID | 69288310 |
| Molecular Formula | C6H7N3O |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | 1-methylfuro[2,3-d]imidazol-5-amine |
| SMILES | Cn1cnc2oc(N)cc21 |
| InChI | InChI=1S/C6H7N3O/c1-9-3-8-6-4(9)2-5(7)10-6/h2-3H,7H2,1H3 |
| InChIKey | ONQSWKZXVYJGIW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |