C29H42O2 — CID 70009993
(5E)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-6,10-dimethyl-3-phenylundeca-2,5,9-triene-1,1-diol (PubChem CID 70009993) has the molecular formula C29H42O2 and a molecular weight of 422.65 g/mol. Its IUPAC name is (5E)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-6,10-dimethyl-3-phenylundeca-2,5,9-triene-1,1-diol.
| Compound Name | (5E)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-6,10-dimethyl-3-phenylundeca-2,5,9-triene-1,1-diol |
|---|---|
| PubChem CID | 70009993 |
| Molecular Formula | C29H42O2 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | (5E)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-6,10-dimethyl-3-phenylundeca-2,5,9-triene-1,1-diol |
| SMILES | CC(C)=CCC/C(C)=C/CC(=C(C/C=C(\C)CCC=C(C)C)C(O)O)c1ccccc1 |
| InChI | InChI=1S/C29H42O2/c1-22(2)12-10-14-24(5)18-20-27(26-16-8-7-9-17-26)28(29(30)31)21-19-25(6)15-11-13-23(3)4/h7-9,12-13,16-19,29-31H,10-11,14-15,20-21H2,1-6H3/b24-18+,25-19+,28-27? |
| InChIKey | KVCIUFOIGYEOSK-YVKCOACYSA-N |
| XLogP | 7.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|