C28H45NO — CID 70291686
(12E,16E)-4,4,6,8,12,16-hexamethyl-17-pyridin-2-ylheptadeca-12,16-dien-5-one (PubChem CID 70291686) has the molecular formula C28H45NO and a molecular weight of 411.67 g/mol. Its IUPAC name is (12E,16E)-4,4,6,8,12,16-hexamethyl-17-pyridin-2-ylheptadeca-12,16-dien-5-one.
| Compound Name | (12E,16E)-4,4,6,8,12,16-hexamethyl-17-pyridin-2-ylheptadeca-12,16-dien-5-one |
|---|---|
| PubChem CID | 70291686 |
| Molecular Formula | C28H45NO |
| Molecular Weight | 411.67 g/mol |
| Exact Mass | 411.35 |
| IUPAC Name | (12E,16E)-4,4,6,8,12,16-hexamethyl-17-pyridin-2-ylheptadeca-12,16-dien-5-one |
| SMILES | CCCC(C)(C)C(=O)C(C)CC(C)CCC/C(C)=C/CC/C(C)=C/c1ccccn1 |
| InChI | InChI=1S/C28H45NO/c1-8-18-28(6,7)27(30)25(5)20-23(3)15-11-13-22(2)14-12-16-24(4)21-26-17-9-10-19-29-26/h9-10,14,17,19,21,23,25H,8,11-13,15-16,18,20H2,1-7H3/b22-14+,24-21+ |
| InChIKey | YEBCMQPSIUGZOP-WZQMDVHMSA-N |
| XLogP | 8.44 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.67 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|