C17H18N2O — CID 71658375
(1R,12S,16S)-16-ethyl-11-methylidene-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-14-one (PubChem CID 71658375) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is (1R,12S,16S)-16-ethyl-11-methylidene-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-14-one.
| Compound Name | (1R,12S,16S)-16-ethyl-11-methylidene-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-14-one |
|---|---|
| PubChem CID | 71658375 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (1R,12S,16S)-16-ethyl-11-methylidene-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-14-one |
| SMILES | C=C1c2[nH]c3ccccc3c2[C@@H]2NC(=O)C[C@H]1[C@@H]2CC |
| InChI | InChI=1S/C17H18N2O/c1-3-10-12-8-14(20)19-17(10)15-11-6-4-5-7-13(11)18-16(15)9(12)2/h4-7,10,12,17-18H,2-3,8H2,1H3,(H,19,20)/t10-,12+,17+/m0/s1 |
| InChIKey | VYWUMSZWSXBPHD-GSDQYQHOSA-N |
| XLogP | 3.40 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |