C19H14FN3O3S — CID 7543351
N-(1,3-benzothiazol-2-yl)-N-[(Z)-(4-fluorophenyl)methylideneamino]-2,3-dihydro-1,4-dioxine-5-carboxamide (PubChem CID 7543351) has the molecular formula C19H14FN3O3S and a molecular weight of 383.40 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-[(Z)-(4-fluorophenyl)methylideneamino]-2,3-dihydro-1,4-dioxine-5-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-[(Z)-(4-fluorophenyl)methylideneamino]-2,3-dihydro-1,4-dioxine-5-carboxamide |
|---|---|
| PubChem CID | 7543351 |
| Molecular Formula | C19H14FN3O3S |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-[(Z)-(4-fluorophenyl)methylideneamino]-2,3-dihydro-1,4-dioxine-5-carboxamide |
| SMILES | O=C(C1=COCCO1)N(/N=C\c1ccc(F)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H14FN3O3S/c20-14-7-5-13(6-8-14)11-21-23(18(24)16-12-25-9-10-26-16)19-22-15-3-1-2-4-17(15)27-19/h1-8,11-12H,9-10H2/b21-11- |
| InChIKey | HLBGKNPLIPOXPM-NHDPSOOVSA-N |
| XLogP | 3.69 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|