C9H14N6O2 — CID 78207353
8-hydrazinyl-3-methyl-7-prop-2-enyl-4,5-dihydropurine-2,6-dione (PubChem CID 78207353) has the molecular formula C9H14N6O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 8-hydrazinyl-3-methyl-7-prop-2-enyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-hydrazinyl-3-methyl-7-prop-2-enyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78207353 |
| Molecular Formula | C9H14N6O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 8-hydrazinyl-3-methyl-7-prop-2-enyl-4,5-dihydropurine-2,6-dione |
| SMILES | C=CCN1C(NN)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C9H14N6O2/c1-3-4-15-5-6(11-8(15)13-10)14(2)9(17)12-7(5)16/h3,5-6H,1,4,10H2,2H3,(H,11,13)(H,12,16,17) |
| InChIKey | HXZNZKFSIUMYQT-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|