C10H16N2O7 — CID 87435281
(1R,5R)-1,5-diamino-4-oxoheptane-1,3,7-tricarboxylic acid (PubChem CID 87435281) has the molecular formula C10H16N2O7 and a molecular weight of 276.24 g/mol. Its IUPAC name is (1R,5R)-1,5-diamino-4-oxoheptane-1,3,7-tricarboxylic acid.
| Compound Name | (1R,5R)-1,5-diamino-4-oxoheptane-1,3,7-tricarboxylic acid |
|---|---|
| PubChem CID | 87435281 |
| Molecular Formula | C10H16N2O7 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (1R,5R)-1,5-diamino-4-oxoheptane-1,3,7-tricarboxylic acid |
| SMILES | N[C@H](CC(C(=O)O)C(=O)[C@H](N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16N2O7/c11-5(1-2-7(13)14)8(15)4(9(16)17)3-6(12)10(18)19/h4-6H,1-3,11-12H2,(H,13,14)(H,16,17)(H,18,19)/t4?,5-,6-/m1/s1 |
| InChIKey | UFYFMOPNIMTIHS-YSLANXFLSA-N |
| XLogP | -1.75 |
| TPSA | 181.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|