C11H18N2O10 — CID 87536446
(2R)-2-aminopentanedioic acid;(3S)-3-aminopropane-1,1,3-tricarboxylic acid (PubChem CID 87536446) has the molecular formula C11H18N2O10 and a molecular weight of 338.27 g/mol. Its IUPAC name is (2R)-2-aminopentanedioic acid;(3S)-3-aminopropane-1,1,3-tricarboxylic acid.
| Compound Name | (2R)-2-aminopentanedioic acid;(3S)-3-aminopropane-1,1,3-tricarboxylic acid |
|---|---|
| PubChem CID | 87536446 |
| Molecular Formula | C11H18N2O10 |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (2R)-2-aminopentanedioic acid;(3S)-3-aminopropane-1,1,3-tricarboxylic acid |
| SMILES | N[C@@H](CC(C(=O)O)C(=O)O)C(=O)O.N[C@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H9NO6.C5H9NO4/c7-3(6(12)13)1-2(4(8)9)5(10)11;6-3(5(9)10)1-2-4(7)8/h2-3H,1,7H2,(H,8,9)(H,10,11)(H,12,13);3H,1-2,6H2,(H,7,8)(H,9,10)/t2*3-/m01/s1 |
| InChIKey | QRBYSIADDOPEGT-OCZOEHNFSA-N |
| XLogP | -2.16 |
| TPSA | 238.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|