C17H17Cl2N5O4S — CID 88643756
(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-N-[2-(4-chlorophenyl)-4-hydroxyazetidin-3-yl]-2-methoxyiminoacetamide (PubChem CID 88643756) has the molecular formula C17H17Cl2N5O4S and a molecular weight of 458.33 g/mol. Its IUPAC name is (2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-N-[2-(4-chlorophenyl)-4-hydroxyazetidin-3-yl]-2-methoxyiminoacetamide.
| Compound Name | (2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-N-[2-(4-chlorophenyl)-4-hydroxyazetidin-3-yl]-2-methoxyiminoacetamide |
|---|---|
| PubChem CID | 88643756 |
| Molecular Formula | C17H17Cl2N5O4S |
| Molecular Weight | 458.33 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | (2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-N-[2-(4-chlorophenyl)-4-hydroxyazetidin-3-yl]-2-methoxyiminoacetamide |
| SMILES | CO/N=C(\C(=O)NC1C(O)NC1c1ccc(Cl)cc1)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C17H17Cl2N5O4S/c1-28-24-13(10-7-29-17(20-10)21-11(25)6-18)15(26)23-14-12(22-16(14)27)8-2-4-9(19)5-3-8/h2-5,7,12,14,16,22,27H,6H2,1H3,(H,23,26)(H,20,21,25)/b24-13- |
| InChIKey | ATUXKIQLJMZURH-CFRMEGHHSA-N |
| XLogP | 1.47 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|