C13H16ClN5O5S2 — CID 88627534
(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyimino-N-[(2R,3S)-3-methoxy-2-methylsulfanyl-4-oxoazetidin-3-yl]acetamide (PubChem CID 88627534) has the molecular formula C13H16ClN5O5S2 and a molecular weight of 421.89 g/mol. Its IUPAC name is (2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyimino-N-[(2R,3S)-3-methoxy-2-methylsulfanyl-4-oxoazetidin-3-yl]acetamide.
| Compound Name | (2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyimino-N-[(2R,3S)-3-methoxy-2-methylsulfanyl-4-oxoazetidin-3-yl]acetamide |
|---|---|
| PubChem CID | 88627534 |
| Molecular Formula | C13H16ClN5O5S2 |
| Molecular Weight | 421.89 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | (2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyimino-N-[(2R,3S)-3-methoxy-2-methylsulfanyl-4-oxoazetidin-3-yl]acetamide |
| SMILES | CO/N=C(\C(=O)N[C@]1(OC)C(=O)N[C@@H]1SC)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C13H16ClN5O5S2/c1-23-13(10(22)17-11(13)25-3)18-9(21)8(19-24-2)6-5-26-12(15-6)16-7(20)4-14/h5,11H,4H2,1-3H3,(H,17,22)(H,18,21)(H,15,16,20)/b19-8-/t11-,13+/m1/s1 |
| InChIKey | LFVKKOXVZVZRCO-QCYGPRPMSA-N |
| XLogP | -0.05 |
| TPSA | 131.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.89 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|