C19H18ClN5O9S2 — CID 173396339
(3S,4R)-3-acetyloxy-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-oxo-4-phenylazetidine-1-sulfonic acid (PubChem CID 173396339) has the molecular formula C19H18ClN5O9S2 and a molecular weight of 559.97 g/mol. Its IUPAC name is (3S,4R)-3-acetyloxy-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-oxo-4-phenylazetidine-1-sulfonic acid.
| Compound Name | (3S,4R)-3-acetyloxy-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-oxo-4-phenylazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 173396339 |
| Molecular Formula | C19H18ClN5O9S2 |
| Molecular Weight | 559.97 g/mol |
| Exact Mass | 559.02 |
| IUPAC Name | (3S,4R)-3-acetyloxy-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-oxo-4-phenylazetidine-1-sulfonic acid |
| SMILES | CON=C(C(=O)N[C@@]1(OC(C)=O)C(=O)N(S(=O)(=O)O)[C@@H]1c1ccccc1)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C19H18ClN5O9S2/c1-10(26)34-19(15(11-6-4-3-5-7-11)25(17(19)29)36(30,31)32)23-16(28)14(24-33-2)12-9-35-18(21-12)22-13(27)8-20/h3-7,9,15H,8H2,1-2H3,(H,23,28)(H,21,22,27)(H,30,31,32)/t15-,19+/m1/s1 |
| InChIKey | KKLOSJAIANFPBB-BEFAXECRSA-N |
| XLogP | 0.43 |
| TPSA | 193.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.97 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|