C9H11N3 — CID 89058885
3-(2-methyl-3,4-dihydropyrazol-3-yl)pyridine (PubChem CID 89058885) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 3-(2-methyl-3,4-dihydropyrazol-3-yl)pyridine.
| Compound Name | 3-(2-methyl-3,4-dihydropyrazol-3-yl)pyridine |
|---|---|
| PubChem CID | 89058885 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 3-(2-methyl-3,4-dihydropyrazol-3-yl)pyridine |
| SMILES | CN1N=CCC1c1cccnc1 |
| InChI | InChI=1S/C9H11N3/c1-12-9(4-6-11-12)8-3-2-5-10-7-8/h2-3,5-7,9H,4H2,1H3 |
| InChIKey | OELXVQNDLABDAL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |