C14H24N4O8S3 — CID 89265784
4-(dihydroxyamino)oxybutyl N-ethyl-N-[(4R)-2-methyl-1,1-dioxo-6-sulfinamoyl-3,4-dihydrothieno[3,2-e]thiazin-4-yl]carbamate (PubChem CID 89265784) has the molecular formula C14H24N4O8S3 and a molecular weight of 472.57 g/mol. Its IUPAC name is 4-(dihydroxyamino)oxybutyl N-ethyl-N-[(4R)-2-methyl-1,1-dioxo-6-sulfinamoyl-3,4-dihydrothieno[3,2-e]thiazin-4-yl]carbamate.
| Compound Name | 4-(dihydroxyamino)oxybutyl N-ethyl-N-[(4R)-2-methyl-1,1-dioxo-6-sulfinamoyl-3,4-dihydrothieno[3,2-e]thiazin-4-yl]carbamate |
|---|---|
| PubChem CID | 89265784 |
| Molecular Formula | C14H24N4O8S3 |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 4-(dihydroxyamino)oxybutyl N-ethyl-N-[(4R)-2-methyl-1,1-dioxo-6-sulfinamoyl-3,4-dihydrothieno[3,2-e]thiazin-4-yl]carbamate |
| SMILES | CCN(C(=O)OCCCCON(O)O)[C@H]1CN(C)S(=O)(=O)c2sc(S(N)=O)cc21 |
| InChI | InChI=1S/C14H24N4O8S3/c1-3-17(14(19)25-6-4-5-7-26-18(20)21)11-9-16(2)29(23,24)13-10(11)8-12(27-13)28(15)22/h8,11,20-21H,3-7,9,15H2,1-2H3/t11-,28?/m0/s1 |
| InChIKey | KRCVXYGMHRZQOC-RPIUDXSGSA-N |
| XLogP | 0.66 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|