C14H26F6N2 — CID 89292903
N-(5,5,7,8,8,8-hexafluoro-3-methyloctyl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 89292903) has the molecular formula C14H26F6N2 and a molecular weight of 336.36 g/mol. Its IUPAC name is N-(5,5,7,8,8,8-hexafluoro-3-methyloctyl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(5,5,7,8,8,8-hexafluoro-3-methyloctyl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 89292903 |
| Molecular Formula | C14H26F6N2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-(5,5,7,8,8,8-hexafluoro-3-methyloctyl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CC(CCNCCCN(C)C)CC(F)(F)CC(F)C(F)(F)F |
| InChI | InChI=1S/C14H26F6N2/c1-11(5-7-21-6-4-8-22(2)3)9-13(16,17)10-12(15)14(18,19)20/h11-12,21H,4-10H2,1-3H3 |
| InChIKey | WOGMODRWPHVIMT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|