About 9-iodopurine
9-iodopurine (PubChem CID 70189684) has the molecular formula C5H3IN4
and a molecular weight of 246.01 g/mol. Its IUPAC name is 9-iodopurine.
Molecular Properties
| Compound Name | 9-iodopurine |
| PubChem CID | 70189684 |
| Molecular Formula | C5H3IN4 |
| Molecular Weight | 246.01 g/mol |
| Exact Mass | 245.94 |
| IUPAC Name | 9-iodopurine |
| SMILES | In1cnc2cncnc21 |
| InChI | InChI=1S/C5H3IN4/c6-10-3-9-4-1-7-2-8-5(4)10/h1-3H |
| InChIKey | FFLQOIMOLZYDJA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.01 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 9-iodopurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-iodopurine?
The IUPAC name of 9-iodopurine (CID 70189684) is 9-iodopurine.
What is the SMILES notation for 9-iodopurine?
The canonical SMILES for 9-iodopurine is In1cnc2cncnc21.
What is the InChIKey of 9-iodopurine?
The InChIKey is FFLQOIMOLZYDJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3IN4/c6-10-3-9-4-1-7-2-8-5(4)10/h1-3H.
What are the key properties of 9-iodopurine?
9-iodopurine has a molecular weight of 246.01 g/mol, XLogP of 1.02, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-iodopurine is sourced from PubChem (CID 70189684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).