C5H7F2O4S- — CID 91042103
1,1-difluoro-2-oxopentane-1-sulfonate (PubChem CID 91042103) has the molecular formula C5H7F2O4S- and a molecular weight of 201.17 g/mol. Its IUPAC name is 1,1-difluoro-2-oxopentane-1-sulfonate.
| Compound Name | 1,1-difluoro-2-oxopentane-1-sulfonate |
|---|---|
| PubChem CID | 91042103 |
| Molecular Formula | C5H7F2O4S- |
| Molecular Weight | 201.17 g/mol |
| Exact Mass | 201.00 |
| IUPAC Name | 1,1-difluoro-2-oxopentane-1-sulfonate |
| SMILES | CCCC(=O)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C5H8F2O4S/c1-2-3-4(8)5(6,7)12(9,10)11/h2-3H2,1H3,(H,9,10,11)/p-1 |
| InChIKey | SCXAZZHJAPPQID-UHFFFAOYSA-M |
| XLogP | 0.49 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.17 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|