C29H54O3 — CID 91542814
1-[1,1-bis(2,6-dimethylhept-1-enoxy)ethoxy]-2,6-dimethylhept-1-ene (PubChem CID 91542814) has the molecular formula C29H54O3 and a molecular weight of 450.75 g/mol. Its IUPAC name is 1-[1,1-bis(2,6-dimethylhept-1-enoxy)ethoxy]-2,6-dimethylhept-1-ene.
| Compound Name | 1-[1,1-bis(2,6-dimethylhept-1-enoxy)ethoxy]-2,6-dimethylhept-1-ene |
|---|---|
| PubChem CID | 91542814 |
| Molecular Formula | C29H54O3 |
| Molecular Weight | 450.75 g/mol |
| Exact Mass | 450.41 |
| IUPAC Name | 1-[1,1-bis(2,6-dimethylhept-1-enoxy)ethoxy]-2,6-dimethylhept-1-ene |
| SMILES | CC(=COC(C)(OC=C(C)CCCC(C)C)OC=C(C)CCCC(C)C)CCCC(C)C |
| InChI | InChI=1S/C29H54O3/c1-23(2)14-11-17-26(7)20-30-29(10,31-21-27(8)18-12-15-24(3)4)32-22-28(9)19-13-16-25(5)6/h20-25H,11-19H2,1-10H3 |
| InChIKey | ARGWAKBUDOJPRI-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.75 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|