C13H22N4O2Si — CID 91737419
1-[tert-butyl(dimethyl)silyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 91737419) has the molecular formula C13H22N4O2Si and a molecular weight of 294.43 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 91737419 |
| Molecular Formula | C13H22N4O2Si |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)n([Si](C)(C)C(C)(C)C)c(=O)n2C |
| InChI | InChI=1S/C13H22N4O2Si/c1-13(2,3)20(6,7)17-11(18)9-10(14-8-15(9)4)16(5)12(17)19/h8H,1-7H3 |
| InChIKey | FQHVVNTURBQLJA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|