C24H36N9O6S+ — CID 10078626
[(4S)-4-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15,18-hexaoxo-2,5,8,11,14,17-hexazabicyclo[17.3.1]tricosa-1(23),19,21-trien-20-yl]methyl-dimethylsulfanium (PubChem CID 10078626) has the molecular formula C24H36N9O6S+ and a molecular weight of 578.68 g/mol. Its IUPAC name is [(4S)-4-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15,18-hexaoxo-2,5,8,11,14,17-hexazabicyclo[17.3.1]tricosa-1(23),19,21-trien-20-yl]methyl-dimethylsulfanium.
| Compound Name | [(4S)-4-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15,18-hexaoxo-2,5,8,11,14,17-hexazabicyclo[17.3.1]tricosa-1(23),19,21-trien-20-yl]methyl-dimethylsulfanium |
|---|---|
| PubChem CID | 10078626 |
| Molecular Formula | C24H36N9O6S+ |
| Molecular Weight | 578.68 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | [(4S)-4-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15,18-hexaoxo-2,5,8,11,14,17-hexazabicyclo[17.3.1]tricosa-1(23),19,21-trien-20-yl]methyl-dimethylsulfanium |
| SMILES | C[S+](C)Cc1ccc2cc1C(=O)NCC(=O)NCC(=O)NCC(=O)NCC(=O)N[C@@H](CCCN=C(N)N)C(=O)N2 |
| InChI | InChI=1S/C24H35N9O6S/c1-40(2)13-14-5-6-15-8-16(14)22(38)31-11-20(36)29-9-18(34)28-10-19(35)30-12-21(37)33-17(23(39)32-15)4-3-7-27-24(25)26/h5-6,8,17H,3-4,7,9-13H2,1-2H3,(H9-,25,26,27,28,29,30,31,32,33,34,35,36,37,38,39)/p+1/t17-/m0/s1 |
| InChIKey | RKJMTGXKOFVIGV-KRWDZBQOSA-O |
| XLogP | -3.37 |
| TPSA | 239.00 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.68 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|