C32H38N2O4 — CID 102194293
[4-[(3-propyl-2,4-dihydro-1,3-benzoxazin-6-yl)iminomethyl]phenyl] 4-heptoxybenzoate (PubChem CID 102194293) has the molecular formula C32H38N2O4 and a molecular weight of 514.67 g/mol. Its IUPAC name is [4-[(3-propyl-2,4-dihydro-1,3-benzoxazin-6-yl)iminomethyl]phenyl] 4-heptoxybenzoate.
| Compound Name | [4-[(3-propyl-2,4-dihydro-1,3-benzoxazin-6-yl)iminomethyl]phenyl] 4-heptoxybenzoate |
|---|---|
| PubChem CID | 102194293 |
| Molecular Formula | C32H38N2O4 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | [4-[(3-propyl-2,4-dihydro-1,3-benzoxazin-6-yl)iminomethyl]phenyl] 4-heptoxybenzoate |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(/C=N/c3ccc4c(c3)CN(CCC)CO4)cc2)cc1 |
| InChI | InChI=1S/C32H38N2O4/c1-3-5-6-7-8-20-36-29-16-11-26(12-17-29)32(35)38-30-14-9-25(10-15-30)22-33-28-13-18-31-27(21-28)23-34(19-4-2)24-37-31/h9-18,21-22H,3-8,19-20,23-24H2,1-2H3/b33-22+ |
| InChIKey | WGNWMQIQJSZJLD-STKMKYKTSA-N |
| XLogP | 7.57 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|