C9H12Cl3NO3 — CID 10661057
2,2,2-trichloro-N-[(2R,3R,6S)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran-3-yl]acetamide (PubChem CID 10661057) has the molecular formula C9H12Cl3NO3 and a molecular weight of 288.56 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(2R,3R,6S)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran-3-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(2R,3R,6S)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran-3-yl]acetamide |
|---|---|
| PubChem CID | 10661057 |
| Molecular Formula | C9H12Cl3NO3 |
| Molecular Weight | 288.56 g/mol |
| Exact Mass | 286.99 |
| IUPAC Name | 2,2,2-trichloro-N-[(2R,3R,6S)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran-3-yl]acetamide |
| SMILES | CO[C@@H]1C=C[C@@H](NC(=O)C(Cl)(Cl)Cl)[C@@H](C)O1 |
| InChI | InChI=1S/C9H12Cl3NO3/c1-5-6(3-4-7(15-2)16-5)13-8(14)9(10,11)12/h3-7H,1-2H3,(H,13,14)/t5-,6-,7+/m1/s1 |
| InChIKey | LTVXRZDKFYXUJM-QYNIQEEDSA-N |
| XLogP | 1.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.56 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|