C29H36O2Si — CID 10813206
(4R)-4-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]-4-prop-2-enylcyclohex-2-en-1-one (PubChem CID 10813206) has the molecular formula C29H36O2Si and a molecular weight of 444.69 g/mol. Its IUPAC name is (4R)-4-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]-4-prop-2-enylcyclohex-2-en-1-one.
| Compound Name | (4R)-4-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]-4-prop-2-enylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 10813206 |
| Molecular Formula | C29H36O2Si |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | (4R)-4-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]-4-prop-2-enylcyclohex-2-en-1-one |
| SMILES | C=CC[C@@]1([C@H](C=C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=CC(=O)CC1 |
| InChI | InChI=1S/C29H36O2Si/c1-6-20-29(21-18-25(30)19-22-29)24(7-2)23-31-32(28(3,4)5,26-14-10-8-11-15-26)27-16-12-9-13-17-27/h6-18,21,24H,1-2,19-20,22-23H2,3-5H3/t24-,29-/m1/s1 |
| InChIKey | BSIPQTVYOOWYKF-FUFSCUOVSA-N |
| XLogP | 5.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|