C26H28ClF6N5O3S — CID 118431688
2-[2-(2-chlorophenyl)-3-[4-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 118431688) has the molecular formula C26H28ClF6N5O3S and a molecular weight of 640.05 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-3-[4-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-(2-chlorophenyl)-3-[4-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 118431688 |
| Molecular Formula | C26H28ClF6N5O3S |
| Molecular Weight | 640.05 g/mol |
| Exact Mass | 639.15 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-3-[4-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)phenyl]-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | O=S(=O)(N1CCCC1)N1CCN(c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C26H28ClF6N5O3S/c27-20-5-1-2-6-21(20)38-22(17-23(34-38)24(39,25(28,29)30)26(31,32)33)18-7-9-19(10-8-18)35-13-15-37(16-14-35)42(40,41)36-11-3-4-12-36/h1-2,5-10,22,39H,3-4,11-17H2 |
| InChIKey | LQCNJEGDGGYPRU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 79.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.05 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|