C21H40N6O14 — CID 118437269
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[carboxymethyl-[2-[carboxymethyl-[2-oxo-2-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentoxy]ethyl]amino]ethyl]amino]acetic acid (PubChem CID 118437269) has the molecular formula C21H40N6O14 and a molecular weight of 600.58 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[carboxymethyl-[2-[carboxymethyl-[2-oxo-2-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentoxy]ethyl]amino]ethyl]amino]acetic acid.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[carboxymethyl-[2-[carboxymethyl-[2-oxo-2-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentoxy]ethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 118437269 |
| Molecular Formula | C21H40N6O14 |
| Molecular Weight | 600.58 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[carboxymethyl-[2-[carboxymethyl-[2-oxo-2-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentoxy]ethyl]amino]ethyl]amino]acetic acid |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)O.O=C(O)CN(CCN(CC(=O)O)CC(=O)OC[C@H](O)[C@@H](O)[C@H](O)CO)CC(=O)O |
| InChI | InChI=1S/C15H26N2O12.C6H14N4O2/c18-7-9(19)15(28)10(20)8-29-14(27)6-17(5-13(25)26)2-1-16(3-11(21)22)4-12(23)24;7-4(5(11)12)2-1-3-10-6(8)9/h9-10,15,18-20,28H,1-8H2,(H,21,22)(H,23,24)(H,25,26);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t9-,10+,15+;4-/m10/s1 |
| InChIKey | VEUGINMVPDYSSP-VBJVYVNLSA-N |
| XLogP | -6.09 |
| TPSA | 353.32 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.58 |
| LogP ≤ 5 | -6.09 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|