About 2-methylsilylacetamide
2-methylsilylacetamide (PubChem CID 123157412) has the molecular formula C3H9NOSi
and a molecular weight of 103.20 g/mol. Its IUPAC name is 2-methylsilylacetamide.
Molecular Properties
| Compound Name | 2-methylsilylacetamide |
| PubChem CID | 123157412 |
| Molecular Formula | C3H9NOSi |
| Molecular Weight | 103.20 g/mol |
| Exact Mass | 103.05 |
| IUPAC Name | 2-methylsilylacetamide |
| SMILES | C[SiH2]CC(N)=O |
| InChI | InChI=1S/C3H9NOSi/c1-6-2-3(4)5/h2,6H2,1H3,(H2,4,5) |
| InChIKey | YRSRARWDRPLZFZ-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.20 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsilylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsilylacetamide?
The IUPAC name of 2-methylsilylacetamide (CID 123157412) is 2-methylsilylacetamide.
What is the SMILES notation for 2-methylsilylacetamide?
The canonical SMILES for 2-methylsilylacetamide is C[SiH2]CC(N)=O.
What is the InChIKey of 2-methylsilylacetamide?
The InChIKey is YRSRARWDRPLZFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NOSi/c1-6-2-3(4)5/h2,6H2,1H3,(H2,4,5).
What are the key properties of 2-methylsilylacetamide?
2-methylsilylacetamide has a molecular weight of 103.20 g/mol, XLogP of -0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsilylacetamide is sourced from PubChem (CID 123157412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).