C13H11BrCl6 — CID 134932084
(1S,4R,5R)-5-(4-bromo-4-methylpent-2-ynyl)-1,2,3,4,7,7-hexachlorobicyclo[2.2.1]hept-2-ene (PubChem CID 134932084) has the molecular formula C13H11BrCl6 and a molecular weight of 459.85 g/mol. Its IUPAC name is (1S,4R,5R)-5-(4-bromo-4-methylpent-2-ynyl)-1,2,3,4,7,7-hexachlorobicyclo[2.2.1]hept-2-ene.
| Compound Name | (1S,4R,5R)-5-(4-bromo-4-methylpent-2-ynyl)-1,2,3,4,7,7-hexachlorobicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 134932084 |
| Molecular Formula | C13H11BrCl6 |
| Molecular Weight | 459.85 g/mol |
| Exact Mass | 455.82 |
| IUPAC Name | (1S,4R,5R)-5-(4-bromo-4-methylpent-2-ynyl)-1,2,3,4,7,7-hexachlorobicyclo[2.2.1]hept-2-ene |
| SMILES | CC(C)(Br)C#CC[C@@H]1C[C@]2(Cl)C(Cl)=C(Cl)[C@@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C13H11BrCl6/c1-10(2,14)5-3-4-7-6-11(17)8(15)9(16)12(7,18)13(11,19)20/h7H,4,6H2,1-2H3/t7-,11+,12-/m1/s1 |
| InChIKey | CTCCOMQRCUVXQN-VSYUYLJXSA-N |
| XLogP | 6.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.85 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|