C27H24N2O4S — CID 137170566
ethyl (5Z)-2-benzoylimino-4-hydroxy-5-[(2-methyl-1-prop-2-enylindol-3-yl)methylidene]thiophene-3-carboxylate (PubChem CID 137170566) has the molecular formula C27H24N2O4S and a molecular weight of 472.57 g/mol. Its IUPAC name is ethyl (5Z)-2-benzoylimino-4-hydroxy-5-[(2-methyl-1-prop-2-enylindol-3-yl)methylidene]thiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-2-benzoylimino-4-hydroxy-5-[(2-methyl-1-prop-2-enylindol-3-yl)methylidene]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 137170566 |
| Molecular Formula | C27H24N2O4S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | ethyl (5Z)-2-benzoylimino-4-hydroxy-5-[(2-methyl-1-prop-2-enylindol-3-yl)methylidene]thiophene-3-carboxylate |
| SMILES | C=CCn1c(C)c(/C=C2\S/C(=N\C(=O)c3ccccc3)C(C(=O)OCC)=C2O)c2ccccc21 |
| InChI | InChI=1S/C27H24N2O4S/c1-4-15-29-17(3)20(19-13-9-10-14-21(19)29)16-22-24(30)23(27(32)33-5-2)26(34-22)28-25(31)18-11-7-6-8-12-18/h4,6-14,16,30H,1,5,15H2,2-3H3/b22-16-,28-26- |
| InChIKey | FELIKZVSKZWGFE-VKUORVKCSA-N |
| XLogP | 5.84 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|