C30H55NO5Si2 — CID 138966020
(1R,2S,3R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(1,3-dioxolan-2-yl)-1-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]pentan-3-ol (PubChem CID 138966020) has the molecular formula C30H55NO5Si2 and a molecular weight of 565.94 g/mol. Its IUPAC name is (1R,2S,3R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(1,3-dioxolan-2-yl)-1-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]pentan-3-ol.
| Compound Name | (1R,2S,3R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(1,3-dioxolan-2-yl)-1-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]pentan-3-ol |
|---|---|
| PubChem CID | 138966020 |
| Molecular Formula | C30H55NO5Si2 |
| Molecular Weight | 565.94 g/mol |
| Exact Mass | 565.36 |
| IUPAC Name | (1R,2S,3R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(1,3-dioxolan-2-yl)-1-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]pentan-3-ol |
| SMILES | C[C@H](c1ccccc1)N1C[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CCC1OCCO1 |
| InChI | InChI=1S/C30H55NO5Si2/c1-22(23-15-13-12-14-16-23)31-21-24(31)27(35-37(8,9)29(2,3)4)28(36-38(10,11)30(5,6)7)25(32)17-18-26-33-19-20-34-26/h12-16,22,24-28,32H,17-21H2,1-11H3/t22-,24+,25-,27-,28+,31?/m1/s1 |
| InChIKey | QTLHSHDVXJLYNH-PZKCAGMKSA-N |
| XLogP | 6.73 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.94 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|