C40H46O5S2Si — CID 138973144
[3-[2,2-bis(benzenesulfonyl)ethyl]-1-adamantyl]oxy-tert-butyl-diphenylsilane (PubChem CID 138973144) has the molecular formula C40H46O5S2Si and a molecular weight of 699.02 g/mol. Its IUPAC name is [3-[2,2-bis(benzenesulfonyl)ethyl]-1-adamantyl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [3-[2,2-bis(benzenesulfonyl)ethyl]-1-adamantyl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 138973144 |
| Molecular Formula | C40H46O5S2Si |
| Molecular Weight | 699.02 g/mol |
| Exact Mass | 698.26 |
| IUPAC Name | [3-[2,2-bis(benzenesulfonyl)ethyl]-1-adamantyl]oxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC12CC3CC(CC(CC(S(=O)(=O)c4ccccc4)S(=O)(=O)c4ccccc4)(C3)C1)C2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H46O5S2Si/c1-38(2,3)48(35-20-12-6-13-21-35,36-22-14-7-15-23-36)45-40-27-31-24-32(28-40)26-39(25-31,30-40)29-37(46(41,42)33-16-8-4-9-17-33)47(43,44)34-18-10-5-11-19-34/h4-23,31-32,37H,24-30H2,1-3H3 |
| InChIKey | JSKHEGJNIOYOKG-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.02 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|