C27H28N4O6 — CID 139517190
3-butyl-8-[[(E)-2-(3-ethenyl-4-oxo-5-phenoxypyran-2-yl)ethenoxy]methyl]-7-ethylpurine-2,6-dione (PubChem CID 139517190) has the molecular formula C27H28N4O6 and a molecular weight of 504.54 g/mol. Its IUPAC name is 3-butyl-8-[[(E)-2-(3-ethenyl-4-oxo-5-phenoxypyran-2-yl)ethenoxy]methyl]-7-ethylpurine-2,6-dione.
| Compound Name | 3-butyl-8-[[(E)-2-(3-ethenyl-4-oxo-5-phenoxypyran-2-yl)ethenoxy]methyl]-7-ethylpurine-2,6-dione |
|---|---|
| PubChem CID | 139517190 |
| Molecular Formula | C27H28N4O6 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 3-butyl-8-[[(E)-2-(3-ethenyl-4-oxo-5-phenoxypyran-2-yl)ethenoxy]methyl]-7-ethylpurine-2,6-dione |
| SMILES | C=Cc1c(/C=C/OCc2nc3c(c(=O)[nH]c(=O)n3CCCC)n2CC)occ(Oc2ccccc2)c1=O |
| InChI | InChI=1S/C27H28N4O6/c1-4-7-14-31-25-23(26(33)29-27(31)34)30(6-3)22(28-25)17-35-15-13-20-19(5-2)24(32)21(16-36-20)37-18-11-9-8-10-12-18/h5,8-13,15-16H,2,4,6-7,14,17H2,1,3H3,(H,29,33,34)/b15-13+ |
| InChIKey | INYFCGHUCULQGK-FYWRMAATSA-N |
| XLogP | 4.28 |
| TPSA | 121.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|