About 2,3-bis(ethenyl)pyrazine;quinoline
2,3-bis(ethenyl)pyrazine;quinoline (PubChem CID 142369879) has the molecular formula C17H15N3
and a molecular weight of 261.33 g/mol. Its IUPAC name is 2,3-bis(ethenyl)pyrazine;quinoline.
Molecular Properties
| Compound Name | 2,3-bis(ethenyl)pyrazine;quinoline |
| PubChem CID | 142369879 |
| Molecular Formula | C17H15N3 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2,3-bis(ethenyl)pyrazine;quinoline |
| SMILES | C=Cc1nccnc1C=C.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C8H8N2/c1-2-6-9-8(4-1)5-3-7-10-9;1-3-7-8(4-2)10-6-5-9-7/h1-7H;3-6H,1-2H2 |
| InChIKey | BEOGRCRZZMMSKH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-bis(ethenyl)pyrazine;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(ethenyl)pyrazine;quinoline?
The IUPAC name of 2,3-bis(ethenyl)pyrazine;quinoline (CID 142369879) is 2,3-bis(ethenyl)pyrazine;quinoline.
What is the SMILES notation for 2,3-bis(ethenyl)pyrazine;quinoline?
The canonical SMILES for 2,3-bis(ethenyl)pyrazine;quinoline is C=Cc1nccnc1C=C.c1ccc2ncccc2c1.
What is the InChIKey of 2,3-bis(ethenyl)pyrazine;quinoline?
The InChIKey is BEOGRCRZZMMSKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C8H8N2/c1-2-6-9-8(4-1)5-3-7-10-9;1-3-7-8(4-2)10-6-5-9-7/h1-7H;3-6H,1-2H2.
What are the key properties of 2,3-bis(ethenyl)pyrazine;quinoline?
2,3-bis(ethenyl)pyrazine;quinoline has a molecular weight of 261.33 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(ethenyl)pyrazine;quinoline is sourced from PubChem (CID 142369879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).