C21H37ClFN3O6 — CID 142528682
(2S,5S)-N-[(1S,2S)-2-chloro-1-[(2R,5R)-6-(formamidomethyl)-3,4,5-trihydroxyoxan-2-yl]propyl]-5-(4-fluorobutyl)azepane-2-carboxamide (PubChem CID 142528682) has the molecular formula C21H37ClFN3O6 and a molecular weight of 481.99 g/mol. Its IUPAC name is (2S,5S)-N-[(1S,2S)-2-chloro-1-[(2R,5R)-6-(formamidomethyl)-3,4,5-trihydroxyoxan-2-yl]propyl]-5-(4-fluorobutyl)azepane-2-carboxamide.
| Compound Name | (2S,5S)-N-[(1S,2S)-2-chloro-1-[(2R,5R)-6-(formamidomethyl)-3,4,5-trihydroxyoxan-2-yl]propyl]-5-(4-fluorobutyl)azepane-2-carboxamide |
|---|---|
| PubChem CID | 142528682 |
| Molecular Formula | C21H37ClFN3O6 |
| Molecular Weight | 481.99 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | (2S,5S)-N-[(1S,2S)-2-chloro-1-[(2R,5R)-6-(formamidomethyl)-3,4,5-trihydroxyoxan-2-yl]propyl]-5-(4-fluorobutyl)azepane-2-carboxamide |
| SMILES | C[C@H](Cl)[C@@H](NC(=O)[C@@H]1CC[C@H](CCCCF)CCN1)[C@H]1OC(CNC=O)[C@H](O)C(O)C1O |
| InChI | InChI=1S/C21H37ClFN3O6/c1-12(22)16(20-19(30)18(29)17(28)15(32-20)10-24-11-27)26-21(31)14-6-5-13(7-9-25-14)4-2-3-8-23/h11-20,25,28-30H,2-10H2,1H3,(H,24,27)(H,26,31)/t12-,13-,14-,15?,16+,17-,18?,19?,20+/m0/s1 |
| InChIKey | XONMDCBYKRPVCZ-LPRIFORWSA-N |
| XLogP | -0.41 |
| TPSA | 140.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.99 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|