C22H37N3O2 — CID 143169342
N-[2-[2,3-dimethyl-4-(2-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl)phenoxy]ethyl]-2-methoxyethanamine (PubChem CID 143169342) has the molecular formula C22H37N3O2 and a molecular weight of 375.56 g/mol. Its IUPAC name is N-[2-[2,3-dimethyl-4-(2-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl)phenoxy]ethyl]-2-methoxyethanamine.
| Compound Name | N-[2-[2,3-dimethyl-4-(2-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl)phenoxy]ethyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 143169342 |
| Molecular Formula | C22H37N3O2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | N-[2-[2,3-dimethyl-4-(2-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl)phenoxy]ethyl]-2-methoxyethanamine |
| SMILES | COCCNCCOc1ccc(C2CCCC3CN(C)CCN32)c(C)c1C |
| InChI | InChI=1S/C22H37N3O2/c1-17-18(2)22(27-15-11-23-10-14-26-4)9-8-20(17)21-7-5-6-19-16-24(3)12-13-25(19)21/h8-9,19,21,23H,5-7,10-16H2,1-4H3 |
| InChIKey | ZAPDQPRLQCCMQF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|