C32H40N6O2 — CID 143397284
(3Z,5Z)-1-[4-[[4-[3-(methylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-2-methylidene-7-phenoxyocta-3,5-dien-1-one (PubChem CID 143397284) has the molecular formula C32H40N6O2 and a molecular weight of 540.71 g/mol. Its IUPAC name is (3Z,5Z)-1-[4-[[4-[3-(methylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-2-methylidene-7-phenoxyocta-3,5-dien-1-one.
| Compound Name | (3Z,5Z)-1-[4-[[4-[3-(methylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-2-methylidene-7-phenoxyocta-3,5-dien-1-one |
|---|---|
| PubChem CID | 143397284 |
| Molecular Formula | C32H40N6O2 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | (3Z,5Z)-1-[4-[[4-[3-(methylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-2-methylidene-7-phenoxyocta-3,5-dien-1-one |
| SMILES | C=C(/C=C\C=C/C(C)Oc1ccccc1)C(=O)N1CCN(Cc2nc(NCCCNC)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C32H40N6O2/c1-25(12-7-8-13-26(2)40-27-14-5-4-6-15-27)32(39)38-22-20-37(21-23-38)24-30-35-29-17-10-9-16-28(29)31(36-30)34-19-11-18-33-3/h4-10,12-17,26,33H,1,11,18-24H2,2-3H3,(H,34,35,36)/b12-7-,13-8- |
| InChIKey | ZOWBRHWIBNQJTJ-AJDRMPRJSA-N |
| XLogP | 4.43 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|