C24H21N3S — CID 144500452
6-(1-benzothiophen-4-yl)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-N-methylquinazolin-4-amine (PubChem CID 144500452) has the molecular formula C24H21N3S and a molecular weight of 383.52 g/mol. Its IUPAC name is 6-(1-benzothiophen-4-yl)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-N-methylquinazolin-4-amine.
| Compound Name | 6-(1-benzothiophen-4-yl)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-N-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 144500452 |
| Molecular Formula | C24H21N3S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 6-(1-benzothiophen-4-yl)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-N-methylquinazolin-4-amine |
| SMILES | C=C/C(=C\C=C/C)c1nc(NC)c2cc(-c3cccc4sccc34)ccc2n1 |
| InChI | InChI=1S/C24H21N3S/c1-4-6-8-16(5-2)23-26-21-12-11-17(15-20(21)24(25-3)27-23)18-9-7-10-22-19(18)13-14-28-22/h4-15H,2H2,1,3H3,(H,25,26,27)/b6-4-,16-8+ |
| InChIKey | VEMBIABPVMCXCL-MZENOTDRSA-N |
| XLogP | 6.70 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|