About 3-ethylhexane;2-methylhexane;prop-1-ene
3-ethylhexane;2-methylhexane;prop-1-ene (PubChem CID 144809780) has the molecular formula C18H40
and a molecular weight of 256.52 g/mol. Its IUPAC name is 3-ethylhexane;2-methylhexane;prop-1-ene.
Molecular Properties
| Compound Name | 3-ethylhexane;2-methylhexane;prop-1-ene |
| PubChem CID | 144809780 |
| Molecular Formula | C18H40 |
| Molecular Weight | 256.52 g/mol |
| Exact Mass | 256.31 |
| IUPAC Name | 3-ethylhexane;2-methylhexane;prop-1-ene |
| SMILES | C=CC.CCCC(CC)CC.CCCCC(C)C |
| InChI | InChI=1S/C8H18.C7H16.C3H6/c1-4-7-8(5-2)6-3;1-4-5-6-7(2)3;1-3-2/h8H,4-7H2,1-3H3;7H,4-6H2,1-3H3;3H,1H2,2H3 |
| InChIKey | PFYJWIARVDDMAQ-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.52 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylhexane;2-methylhexane;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylhexane;2-methylhexane;prop-1-ene?
The IUPAC name of 3-ethylhexane;2-methylhexane;prop-1-ene (CID 144809780) is 3-ethylhexane;2-methylhexane;prop-1-ene.
What is the SMILES notation for 3-ethylhexane;2-methylhexane;prop-1-ene?
The canonical SMILES for 3-ethylhexane;2-methylhexane;prop-1-ene is C=CC.CCCC(CC)CC.CCCCC(C)C.
What is the InChIKey of 3-ethylhexane;2-methylhexane;prop-1-ene?
The InChIKey is PFYJWIARVDDMAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C7H16.C3H6/c1-4-7-8(5-2)6-3;1-4-5-6-7(2)3;1-3-2/h8H,4-7H2,1-3H3;7H,4-6H2,1-3H3;3H,1H2,2H3.
What are the key properties of 3-ethylhexane;2-methylhexane;prop-1-ene?
3-ethylhexane;2-methylhexane;prop-1-ene has a molecular weight of 256.52 g/mol, XLogP of 7.25, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylhexane;2-methylhexane;prop-1-ene is sourced from PubChem (CID 144809780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).