C30H22F9N3O3S — CID 144882112
N-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfinylcyclobutyl]-1H-pyrazole-4-carboxamide (PubChem CID 144882112) has the molecular formula C30H22F9N3O3S and a molecular weight of 675.57 g/mol. Its IUPAC name is N-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfinylcyclobutyl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfinylcyclobutyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 144882112 |
| Molecular Formula | C30H22F9N3O3S |
| Molecular Weight | 675.57 g/mol |
| Exact Mass | 675.12 |
| IUPAC Name | N-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfinylcyclobutyl]-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NC1CC(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)c2ccc(F)cc2)C1)c1cn[nH]c1 |
| InChI | InChI=1S/C30H22F9N3O3S/c31-20-8-10-22(11-9-20)46(44)27(12-21(13-27)42-26(43)17-14-40-41-15-17)18-4-6-19(7-5-18)28(29(34,35)36,30(37,38)39)45-16-23-24(32)2-1-3-25(23)33/h1-11,14-15,21H,12-13,16H2,(H,40,41)(H,42,43) |
| InChIKey | SSXQAOVNKBIVQU-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.57 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |